CAS 54118-66-0 is the registry number for Butinoline Phosphate. Offered by: TRC. Available pack sizes: 1g.
Dihydrogen phosphate;1,1-diphenyl-4-pyrrolidin-1-ium-1-ylbut-2-yn-1-ol (CAS 54118-66-0) is a chemical compound with the molecular formula C20H24NO5P and a molecular weight of 389.4 g/mol. IUPAC name: dihydrogen phosphate;1,1-diphenyl-4-pyrrolidin-1-ium-1-ylbut-2-yn-1-ol. InChIKey: KJRDQHIYWCTNTN-UHFFFAOYSA-N.
| Molecular formula | C20H24NO5P |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | dihydrogen phosphate;1,1-diphenyl-4-pyrrolidin-1-ium-1-ylbut-2-yn-1-ol |
| InChIKey | KJRDQHIYWCTNTN-UHFFFAOYSA-N |
| SMILES | C1CC[NH+](C1)CC#CC(C2=CC=CC=C2)(C3=CC=CC=C3)O.OP(=O)(O)[O-] |
Computed by PubChem (NCBI)