CAS 541545-55-5 is the registry number for N-(2,4-Dibromophenyl)-4-methoxybenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(2,4-dibromophenyl)-4-methoxybenzamide (CAS 541545-55-5) is a chemical compound with the molecular formula C14H11Br2NO2 and a molecular weight of 385.05 g/mol. IUPAC name: N-(2,4-dibromophenyl)-4-methoxybenzamide. InChIKey: MEEOWNOOARIQDA-UHFFFAOYSA-N.
| Molecular formula | C14H11Br2NO2 |
|---|---|
| Molecular weight | 385.05 g/mol |
| IUPAC name | N-(2,4-dibromophenyl)-4-methoxybenzamide |
| InChIKey | MEEOWNOOARIQDA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)NC2=C(C=C(C=C2)Br)Br |
Computed by PubChem (NCBI)