CAS 5416-22-8 is the registry number for 3,6-Dibromo-1-nitro-9h-carbazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3,6-dibromo-1-nitro-9H-carbazole (CAS 5416-22-8) is a chemical compound with the molecular formula C12H6Br2N2O2 and a molecular weight of 370.00 g/mol. IUPAC name: 3,6-dibromo-1-nitro-9H-carbazole. InChIKey: XRMUUSATUCOGCF-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2N2O2 |
|---|---|
| Molecular weight | 370.00 g/mol |
| IUPAC name | 3,6-dibromo-1-nitro-9H-carbazole |
| InChIKey | XRMUUSATUCOGCF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C3=C(N2)C(=CC(=C3)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)