Products 54166-79-9
CAS 54166-79-9 is the registry number for Ethyl [2-nitro-4-(trifluoromethyl)anilino](oxo)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Ethyl 2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoacetate (CAS 54166-79-9) is a chemical compound with the molecular formula C11H9F3N2O5 and a molecular weight of 306.19 g/mol. IUPAC name: ethyl 2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoacetate. InChIKey: HPWJLXSOUJRZLN-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2O5 |
|---|---|
| Molecular weight | 306.19 g/mol |
| IUPAC name | ethyl 2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoacetate |
| InChIKey | HPWJLXSOUJRZLN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)NC1=C(C=C(C=C1)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)