CAS 54172-90-6 appears in our catalog under these names: Bisphenol F Monosulfate Sodium Salt, Bisphenol F sulfate sodium salt. Offered by: TRC, HPC Standards. Available pack sizes: 100mg, 50mg, 1x10mg.
Sodium [4-[(4-hydroxyphenyl)methyl]phenyl] sulfate (CAS 54172-90-6) is a chemical compound with the molecular formula C13H11NaO5S and a molecular weight of 302.28 g/mol. IUPAC name: sodium [4-[(4-hydroxyphenyl)methyl]phenyl] sulfate. InChIKey: SLTUHBZGAKLROW-UHFFFAOYSA-M.
| Molecular formula | C13H11NaO5S |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | sodium [4-[(4-hydroxyphenyl)methyl]phenyl] sulfate |
| InChIKey | SLTUHBZGAKLROW-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)OS(=O)(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)