CAS 5419-77-2 is the registry number for 1–Naphthol–5–sulfonic Acid Sodium Salt. Offered by: GLPBio. Available pack sizes: 100g.
Sodium 5-hydroxynaphthalene-1-sulfonate (CAS 5419-77-2) is a chemical compound with the molecular formula C10H7NaO4S and a molecular weight of 246.22 g/mol. IUPAC name: sodium 5-hydroxynaphthalene-1-sulfonate. InChIKey: HWQLBKMVMXBGRC-UHFFFAOYSA-M.
| Molecular formula | C10H7NaO4S |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | sodium 5-hydroxynaphthalene-1-sulfonate |
| InChIKey | HWQLBKMVMXBGRC-UHFFFAOYSA-M |
| SMILES | C1=CC2=C(C=CC=C2S(=O)(=O)[O-])C(=C1)O.[Na+] |
Computed by PubChem (NCBI)