CAS 54196-62-2 is the registry number for Triazolam Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
[5-chloro-2-[3-(hydroxymethyl)-5-methyl-1,2,4-triazol-4-yl]phenyl]-(2-chlorophenyl)methanone (CAS 54196-62-2) is a chemical compound with the molecular formula C17H13Cl2N3O2 and a molecular weight of 362.2 g/mol. IUPAC name: [5-chloro-2-[3-(hydroxymethyl)-5-methyl-1,2,4-triazol-4-yl]phenyl]-(2-chlorophenyl)methanone. InChIKey: AXAAMTSBUQOVSO-UHFFFAOYSA-N.
| Molecular formula | C17H13Cl2N3O2 |
|---|---|
| Molecular weight | 362.2 g/mol |
| IUPAC name | [5-chloro-2-[3-(hydroxymethyl)-5-methyl-1,2,4-triazol-4-yl]phenyl]-(2-chlorophenyl)methanone |
| InChIKey | AXAAMTSBUQOVSO-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(N1C2=C(C=C(C=C2)Cl)C(=O)C3=CC=CC=C3Cl)CO |
Computed by PubChem (NCBI)