CAS 54197-31-8 appears in our catalog under these names: R(+)-IAA 94, R(+)-IAA-94/ 99.22% (existing batch purity), IAA–94, R(+)-Methylindazone 98%, 2-[[(2R)-6,7-Dichloro-2-cyclopentyl-2,3-dihydro-2-methyl-1-oxo-1H-inden-5-yl]oxy]acetic acid, 98%, 98%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 2mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 100mg.
2-[[(2R)-6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl]oxy]acetic acid (CAS 54197-31-8) is a chemical compound with the molecular formula C17H18Cl2O4 and a molecular weight of 357.2 g/mol. IUPAC name: 2-[[(2R)-6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl]oxy]acetic acid. InChIKey: RNOJGTHBMJBOSP-QGZVFWFLSA-N.
| Molecular formula | C17H18Cl2O4 |
|---|---|
| Molecular weight | 357.2 g/mol |
| IUPAC name | 2-[[(2R)-6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl]oxy]acetic acid |
| InChIKey | RNOJGTHBMJBOSP-QGZVFWFLSA-N |
| SMILES | C[C@@]1(CC2=CC(=C(C(=C2C1=O)Cl)Cl)OCC(=O)O)C3CCCC3 |
Computed by PubChem (NCBI)