Products 54197-78-3
CAS 54197-78-3 is the registry number for 6-Bromo-2-(3,4-dimethoxyphenyl)-4H-chromen-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-bromo-2-(3,4-dimethoxyphenyl)chromen-4-one (CAS 54197-78-3) is a chemical compound with the molecular formula C17H13BrO4 and a molecular weight of 361.2 g/mol. IUPAC name: 6-bromo-2-(3,4-dimethoxyphenyl)chromen-4-one. InChIKey: QQAYBGFNXBCAEU-UHFFFAOYSA-N.
| Molecular formula | C17H13BrO4 |
|---|---|
| Molecular weight | 361.2 g/mol |
| IUPAC name | 6-bromo-2-(3,4-dimethoxyphenyl)chromen-4-one |
| InChIKey | QQAYBGFNXBCAEU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(O2)C=CC(=C3)Br)OC |
Computed by PubChem (NCBI)