CAS 54200-67-8 appears in our catalog under these names: 2,3,6-Trimethylacetophenone, 95%, (2',3',6'-Trimethyl)acetophenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 50g, 10g, 5g.
1-(2,3,6-trimethylphenyl)ethanone (CAS 54200-67-8) is a chemical compound with the molecular formula C11H14O and a molecular weight of 162.23 g/mol. IUPAC name: 1-(2,3,6-trimethylphenyl)ethanone. InChIKey: FTKUYCGSPCDDGD-UHFFFAOYSA-N.
| Molecular formula | C11H14O |
|---|---|
| Molecular weight | 162.23 g/mol |
| IUPAC name | 1-(2,3,6-trimethylphenyl)ethanone |
| InChIKey | FTKUYCGSPCDDGD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C)C(=O)C)C |
Computed by PubChem (NCBI)