CAS 5421-53-4 appears in our catalog under these names: Bis(4–(tert–butyl)phenyl)iodoniumchloride, Bis(4-(tert-butyl)phenyl)iodonium chloride, 98%, Bis(4-tert-butylphenyl)iodonium Chloride, >98.0%(HPLC)(T), Bis(4-(tert-butyl)phenyl)iodonium chloride, 97%, 97%. Offered by: GLPBio, Fluorochem, TCI, Chemat. Available pack sizes: 25g, 5g, 100g, 1g, 10g, 500g.
Bis(4-tert-butylphenyl)iodanium chloride (CAS 5421-53-4) is a chemical compound with the molecular formula C20H26ClI and a molecular weight of 428.8 g/mol. IUPAC name: bis(4-tert-butylphenyl)iodanium chloride. InChIKey: JHPUIEDIXRYPTP-UHFFFAOYSA-M.
| Molecular formula | C20H26ClI |
|---|---|
| Molecular weight | 428.8 g/mol |
| IUPAC name | bis(4-tert-butylphenyl)iodanium chloride |
| InChIKey | JHPUIEDIXRYPTP-UHFFFAOYSA-M |
| SMILES | CC(C)(C)C1=CC=C(C=C1)[I+]C2=CC=C(C=C2)C(C)(C)C.[Cl-] |
Computed by PubChem (NCBI)