Products 54234-12-7

CAS 54234-12-7 is the registry number for Isatin dianilide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.

Structural formula: {0} (CAS {1})

N-phenyl-3-phenyliminoindol-2-amine (CAS 54234-12-7) is a chemical compound with the molecular formula C20H15N3 and a molecular weight of 297.4 g/mol. IUPAC name: N-phenyl-3-phenyliminoindol-2-amine. InChIKey: LABGTOMLTAIIPU-UHFFFAOYSA-N.

Identity
Molecular formulaC20H15N3
Molecular weight297.4 g/mol
IUPAC nameN-phenyl-3-phenyliminoindol-2-amine
InChIKeyLABGTOMLTAIIPU-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)NC2=NC3=CC=CC=C3C2=NC4=CC=CC=C4

Computed by PubChem (NCBI)