Products 54247-23-3
CAS 54247-23-3 is the registry number for Myrtucommulone B. Offered by: Sigma-Aldrich. Available pack sizes: 1MG.
6,8-dihydroxy-2,2,4,4-tetramethyl-5-(2-methylpropanoyl)-9-propan-2-yl-9H-xanthene-1,3-dione (CAS 54247-23-3) is a chemical compound with the molecular formula C24H30O6 and a molecular weight of 414.5 g/mol. IUPAC name: 6,8-dihydroxy-2,2,4,4-tetramethyl-5-(2-methylpropanoyl)-9-propan-2-yl-9H-xanthene-1,3-dione. InChIKey: AYAUOXWJIWVPSO-UHFFFAOYSA-N.
| Molecular formula | C24H30O6 |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | 6,8-dihydroxy-2,2,4,4-tetramethyl-5-(2-methylpropanoyl)-9-propan-2-yl-9H-xanthene-1,3-dione |
| InChIKey | AYAUOXWJIWVPSO-UHFFFAOYSA-N |
| SMILES | CC(C)C1C2=C(C(=C(C=C2O)O)C(=O)C(C)C)OC3=C1C(=O)C(C(=O)C3(C)C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Myrtucommulone B, orb1991982