Products 54268-70-1
CAS 54268-70-1 appears in our catalog under these names: VIS-638 Pentamethine-, Cyanine Chloride, 1 g, glass, Dimethylindodicarbocyanine, Cy5 dimethyl, VIS-638 Pentamethine-, Cyanine Chloride, 5 g, plastic, VIS-638 Pentamethine-, Cyanine Chloride, 10 g, plastic. Offered by: Roth, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 500 mg, 100 mg, 1 g, 10g.
(2E)-1,3,3-trimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indole chloride (CAS 54268-70-1) is a chemical compound with the molecular formula C27H31ClN2 and a molecular weight of 419.0 g/mol. IUPAC name: (2E)-1,3,3-trimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indole chloride. InChIKey: KVISPVDSKYDJKS-UHFFFAOYSA-M.
| Molecular formula | C27H31ClN2 |
|---|---|
| Molecular weight | 419.0 g/mol |
| IUPAC name | (2E)-1,3,3-trimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indole chloride |
| InChIKey | KVISPVDSKYDJKS-UHFFFAOYSA-M |
| SMILES | CC1(C2=CC=CC=C2[N+](=C1/C=C/C=C/C=C/3\C(C4=CC=CC=C4N3C)(C)C)C)C.[Cl-] |
Computed by PubChem (NCBI)