Products 54342-55-1
CAS 54342-55-1 is the registry number for Pyridinium, 4-methyl-1-propyl-, iodide, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
4-methyl-1-propylpyridin-1-ium iodide (CAS 54342-55-1) is a chemical compound with the molecular formula C9H14IN and a molecular weight of 263.12 g/mol. IUPAC name: 4-methyl-1-propylpyridin-1-ium iodide. InChIKey: HLAYBASLRQCFTR-UHFFFAOYSA-M.
| Molecular formula | C9H14IN |
|---|---|
| Molecular weight | 263.12 g/mol |
| IUPAC name | 4-methyl-1-propylpyridin-1-ium iodide |
| InChIKey | HLAYBASLRQCFTR-UHFFFAOYSA-M |
| SMILES | CCC[N+]1=CC=C(C=C1)C.[I-] |
Computed by PubChem (NCBI)