Products 54364-30-6

CAS 54364-30-6 is the registry number for 4,6-Dimethyl-2-sulfanylpyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

4,6-dimethyl-2-sulfanylidene-1H-pyridine-3-carboxylic acid (CAS 54364-30-6) is a chemical compound with the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. IUPAC name: 4,6-dimethyl-2-sulfanylidene-1H-pyridine-3-carboxylic acid. InChIKey: ZBGCJKMWDWJDAE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO2S
Molecular weight183.23 g/mol
IUPAC name4,6-dimethyl-2-sulfanylidene-1H-pyridine-3-carboxylic acid
InChIKeyZBGCJKMWDWJDAE-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=S)N1)C(=O)O)C

Computed by PubChem (NCBI)