CAS 543694-19-5 is the registry number for 3-((1,3,3-Trimethyl-6-azabicyclo[3.2.1]octan-6-yl)sulfonyl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)sulfonyl]aniline (CAS 543694-19-5) is a chemical compound with the molecular formula C16H24N2O2S and a molecular weight of 308.4 g/mol. IUPAC name: 3-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)sulfonyl]aniline. InChIKey: SBJAAFMZXQXSCV-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O2S |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 3-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)sulfonyl]aniline |
| InChIKey | SBJAAFMZXQXSCV-UHFFFAOYSA-N |
| SMILES | CC1(CC2CC(C1)(CN2S(=O)(=O)C3=CC=CC(=C3)N)C)C |
Computed by PubChem (NCBI)