Products 54378-87-9

CAS 54378-87-9 appears in our catalog under these names: 1,1-Cyclopentanedicarboxylic acid 1-ethyl ester, 97%, 1,1-Cyclopentanedicarboxylic acid 1-ethyl ester, 95%, 1-(Ethoxycarbonyl)cyclopentane-1-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 10g, 0,5g.

Structural formula: {0} (CAS {1})

1-ethoxycarbonylcyclopentane-1-carboxylate (CAS 54378-87-9) is a chemical compound with the molecular formula C9H13O4- and a molecular weight of 185.20 g/mol. IUPAC name: 1-ethoxycarbonylcyclopentane-1-carboxylate. InChIKey: SMIYHPHDBDKZTR-UHFFFAOYSA-M.

Identity
Molecular formulaC9H13O4-
Molecular weight185.20 g/mol
IUPAC name1-ethoxycarbonylcyclopentane-1-carboxylate
InChIKeySMIYHPHDBDKZTR-UHFFFAOYSA-M
SMILESCCOC(=O)C1(CCCC1)C(=O)[O-]

Computed by PubChem (NCBI)