CAS 54378-87-9 appears in our catalog under these names: 1,1-Cyclopentanedicarboxylic acid 1-ethyl ester, 97%, 1,1-Cyclopentanedicarboxylic acid 1-ethyl ester, 95%, 1-(Ethoxycarbonyl)cyclopentane-1-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 10g, 0,5g.
1-ethoxycarbonylcyclopentane-1-carboxylate (CAS 54378-87-9) is a chemical compound with the molecular formula C9H13O4- and a molecular weight of 185.20 g/mol. IUPAC name: 1-ethoxycarbonylcyclopentane-1-carboxylate. InChIKey: SMIYHPHDBDKZTR-UHFFFAOYSA-M.
| Molecular formula | C9H13O4- |
|---|---|
| Molecular weight | 185.20 g/mol |
| IUPAC name | 1-ethoxycarbonylcyclopentane-1-carboxylate |
| InChIKey | SMIYHPHDBDKZTR-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C1(CCCC1)C(=O)[O-] |
Computed by PubChem (NCBI)