CAS 5439-87-2 appears in our catalog under these names: Carbocisteine Impurity 2(Carbocisteine S-Oxide), S-Carboxymethyl- L-Cysteine Sulfoxide (Carbocisteine S-Oxide), Carbocisteine S-Oxide (S-Carboxymethyl-L-Cysteine Sulfoxide), (2R)-2-Amino-3-((carboxymethyl)sulfinyl)propanoic acid, 97%, Carbocisteine Sulfoxide(Mixture of diastereomers). Offered by: Hubei YoungXin, Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 2,5g, 250mg.
2-amino-3-(carboxymethylsulfinyl)propanoic acid (CAS 5439-87-2) is a chemical compound with the molecular formula C5H9NO5S and a molecular weight of 195.20 g/mol. IUPAC name: 2-amino-3-(carboxymethylsulfinyl)propanoic acid. InChIKey: DUGSIUCROZRSMS-UHFFFAOYSA-N.
| Molecular formula | C5H9NO5S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 2-amino-3-(carboxymethylsulfinyl)propanoic acid |
| InChIKey | DUGSIUCROZRSMS-UHFFFAOYSA-N |
| SMILES | C(C(C(=O)O)N)S(=O)CC(=O)O |
Computed by PubChem (NCBI)