CAS 543910-82-3 appears in our catalog under these names: CIs–4–Oxo–Octahydro–Isoindole–2–Carboxylic Acid Tert–Butyl Ester, Cis-4-Oxo-Octahydro-Isoindole-2-Carboxylic Acid Tert-Butyl Ester. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 50mg, 0,5g.
Tert-butyl (3aR,7aS)-7-oxo-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carboxylate (CAS 543910-82-3) is a chemical compound with the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. IUPAC name: tert-butyl (3aR,7aS)-7-oxo-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carboxylate. InChIKey: SGPWUVURFSJYQO-VHSXEESVSA-N.
| Molecular formula | C13H21NO3 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | tert-butyl (3aR,7aS)-7-oxo-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carboxylate |
| InChIKey | SGPWUVURFSJYQO-VHSXEESVSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CCCC(=O)[C@@H]2C1 |
Computed by PubChem (NCBI)