CAS 54429-66-2 is the registry number for 2-(4-Nitrophenoxy)ethane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(4-nitrophenoxy)ethanesulfonyl chloride (CAS 54429-66-2) is a chemical compound with the molecular formula C8H8ClNO5S and a molecular weight of 265.67 g/mol. IUPAC name: 2-(4-nitrophenoxy)ethanesulfonyl chloride. InChIKey: BMHHYKNEAPWIPU-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO5S |
|---|---|
| Molecular weight | 265.67 g/mol |
| IUPAC name | 2-(4-nitrophenoxy)ethanesulfonyl chloride |
| InChIKey | BMHHYKNEAPWIPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OCCS(=O)(=O)Cl |
Computed by PubChem (NCBI)