Products 54435-09-5

CAS 54435-09-5 appears in our catalog under these names: 2–Iodo–4–methoxybenzoic acid, 2-Iodo-4-methoxybenzoic acid 95%, Benzoic acid, 2-iodo-4-methoxy-, 95%, 95%, 2-Iodo-4-methoxybenzoic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-iodo-4-methoxybenzoic acid (CAS 54435-09-5) is a chemical compound with the molecular formula C8H7IO3 and a molecular weight of 278.04 g/mol. IUPAC name: 2-iodo-4-methoxybenzoic acid. InChIKey: QBPHOFYPURZIKS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7IO3
Molecular weight278.04 g/mol
IUPAC name2-iodo-4-methoxybenzoic acid
InChIKeyQBPHOFYPURZIKS-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)C(=O)O)I

Computed by PubChem (NCBI)