CAS 544460-63-1 is the registry number for N,N-Diisopropyl 4-fluorobenzenesulfonamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 5g, 1g.
4-fluoro-N,N-di(propan-2-yl)benzenesulfonamide (CAS 544460-63-1) is a chemical compound with the molecular formula C12H18FNO2S and a molecular weight of 259.34 g/mol. IUPAC name: 4-fluoro-N,N-di(propan-2-yl)benzenesulfonamide. InChIKey: NTOPLBVWWPTGQR-UHFFFAOYSA-N.
| Molecular formula | C12H18FNO2S |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | 4-fluoro-N,N-di(propan-2-yl)benzenesulfonamide |
| InChIKey | NTOPLBVWWPTGQR-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)S(=O)(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)