CAS 544482-14-6 is the registry number for Iguratimod Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
N-formyl-N-[2-[4-(methanesulfonamido)-2-methoxy-5-phenoxyphenyl]-2-oxoethyl]formamide (CAS 544482-14-6) is a chemical compound with the molecular formula C18H18N2O7S and a molecular weight of 406.4 g/mol. IUPAC name: N-formyl-N-[2-[4-(methanesulfonamido)-2-methoxy-5-phenoxyphenyl]-2-oxoethyl]formamide. InChIKey: ULNBXPYLVHKRBW-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O7S |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | N-formyl-N-[2-[4-(methanesulfonamido)-2-methoxy-5-phenoxyphenyl]-2-oxoethyl]formamide |
| InChIKey | ULNBXPYLVHKRBW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)CN(C=O)C=O)OC2=CC=CC=C2)NS(=O)(=O)C |
Computed by PubChem (NCBI)