CAS 54455-37-7 appears in our catalog under these names: 2-(Chloromethyl)-5-nitroisoindoline-1,3-dione, 98%, N–Chloromethyl–4–nitrophthalimide, 2-(Chloromethyl)-5-nitroisoindoline-1,3-dione. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 200mg, 5g.
2-(chloromethyl)-5-nitroisoindole-1,3-dione (CAS 54455-37-7) is a chemical compound with the molecular formula C9H5ClN2O4 and a molecular weight of 240.60 g/mol. IUPAC name: 2-(chloromethyl)-5-nitroisoindole-1,3-dione. InChIKey: YXMUGXUCSVUONH-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O4 |
|---|---|
| Molecular weight | 240.60 g/mol |
| IUPAC name | 2-(chloromethyl)-5-nitroisoindole-1,3-dione |
| InChIKey | YXMUGXUCSVUONH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=O)N(C2=O)CCl |
Computed by PubChem (NCBI)