CAS 54459-64-2 is the registry number for 2,4,6-Tribromobenzyl Bromide. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
1,3,5-tribromo-2-(bromomethyl)benzene (CAS 54459-64-2) is a chemical compound with the molecular formula C7H4Br4 and a molecular weight of 407.72 g/mol. IUPAC name: 1,3,5-tribromo-2-(bromomethyl)benzene. InChIKey: PBGWOOMFRJYYKD-UHFFFAOYSA-N.
| Molecular formula | C7H4Br4 |
|---|---|
| Molecular weight | 407.72 g/mol |
| IUPAC name | 1,3,5-tribromo-2-(bromomethyl)benzene |
| InChIKey | PBGWOOMFRJYYKD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)CBr)Br)Br |
Computed by PubChem (NCBI)