CAS 5447-60-9 appears in our catalog under these names: 5-Keto-d-gluconic acid potassium salt, 95%, 5–Keto–D–gluconic acid potassium salt, 5-Keto-D-gluconic acid potassium salt, 98% , 5-Keto-D-gluconic acid potassium salt, 5-Keto-D-gluconic acid potassium salt, min. 99 %, 5 g. Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 25g, 5g, 10g, 1g, 100g, 50g.
Potassium (2R,3S,4S)-2,3,4,6-tetrahydroxy-5-oxohexanoate (CAS 5447-60-9) is a chemical compound with the molecular formula C6H9KO7 and a molecular weight of 232.23 g/mol. IUPAC name: potassium (2R,3S,4S)-2,3,4,6-tetrahydroxy-5-oxohexanoate. InChIKey: GSFHMOMWXNDPMM-YMDUGQBDSA-M.
| Molecular formula | C6H9KO7 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | potassium (2R,3S,4S)-2,3,4,6-tetrahydroxy-5-oxohexanoate |
| InChIKey | GSFHMOMWXNDPMM-YMDUGQBDSA-M |
| SMILES | C(C(=O)[C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O.[K+] |
Computed by PubChem (NCBI)