CAS 5449-12-7 appears in our catalog under these names: BMK Glycidic Acid (sodium salt), 2-Methyl-3-phenyloxirane-2-carboxylic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
Sodium 2-methyl-3-phenyloxirane-2-carboxylic acid (CAS 5449-12-7) is a chemical compound with the molecular formula C10H10NaO3+ and a molecular weight of 201.17 g/mol. IUPAC name: sodium 2-methyl-3-phenyloxirane-2-carboxylic acid. InChIKey: LGZQUMKWUFFHOV-UHFFFAOYSA-N.
| Molecular formula | C10H10NaO3+ |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | sodium 2-methyl-3-phenyloxirane-2-carboxylic acid |
| InChIKey | LGZQUMKWUFFHOV-UHFFFAOYSA-N |
| SMILES | CC1(C(O1)C2=CC=CC=C2)C(=O)O.[Na+] |
Computed by PubChem (NCBI)