CAS 54494-12-1 is the registry number for 4-(3-Phenyl-1,2,4-oxadiazol-5-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
4-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline (CAS 54494-12-1) is a chemical compound with the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. IUPAC name: 4-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline. InChIKey: GUPGUFMJVVCPCZ-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O |
|---|---|
| Molecular weight | 237.26 g/mol |
| IUPAC name | 4-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline |
| InChIKey | GUPGUFMJVVCPCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)