CAS 5451-44-5 is the registry number for Fasudil Hydrochloride impurity G. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-bis(benzenesulfonyl)-1,4-diazepane (CAS 5451-44-5) is a chemical compound with the molecular formula C17H20N2O4S2 and a molecular weight of 380.5 g/mol. IUPAC name: 1,4-bis(benzenesulfonyl)-1,4-diazepane. InChIKey: FCGCYYIJRZRGDT-UHFFFAOYSA-N.
| Molecular formula | C17H20N2O4S2 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | 1,4-bis(benzenesulfonyl)-1,4-diazepane |
| InChIKey | FCGCYYIJRZRGDT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN(C1)S(=O)(=O)C2=CC=CC=C2)S(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)