CAS 54537-87-0 is the registry number for 4-(DICHLOROMETHYL)-2,6-BIS(1,1-DIMETHYLETHYL)-4-METHYL-2,5-CYCLOHEXADIEN-1-ONE, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg.
2,6-ditert-butyl-4-(dichloromethyl)-4-methylcyclohexa-2,5-dien-1-one (CAS 54537-87-0) is a chemical compound with the molecular formula C16H24Cl2O and a molecular weight of 303.3 g/mol. IUPAC name: 2,6-ditert-butyl-4-(dichloromethyl)-4-methylcyclohexa-2,5-dien-1-one. InChIKey: LJEFTNVYDZZYTA-UHFFFAOYSA-N.
| Molecular formula | C16H24Cl2O |
|---|---|
| Molecular weight | 303.3 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-(dichloromethyl)-4-methylcyclohexa-2,5-dien-1-one |
| InChIKey | LJEFTNVYDZZYTA-UHFFFAOYSA-N |
| SMILES | CC1(C=C(C(=O)C(=C1)C(C)(C)C)C(C)(C)C)C(Cl)Cl |
Computed by PubChem (NCBI)