Products 545374-76-3
CAS 545374-76-3 appears in our catalog under these names: 2’-O-(2-Methoxyethyl) inosine, 97.0%, 2’-O-(2-Methoxyethyl) inosine, 98%, 2′-O-(2-Methoxyethyl)inosine, 95%. Offered by: MedChemExpress, Fluorochem, Chemat. Available pack sizes: 50 mg, 100 mg, 5 mg, 25 mg, 10 mg, 100mg, 250mg, 1g.
9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)oxolan-2-yl]-1H-purin-6-one (CAS 545374-76-3) is a chemical compound with the molecular formula C13H18N4O6 and a molecular weight of 326.31 g/mol. IUPAC name: 9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)oxolan-2-yl]-1H-purin-6-one. InChIKey: YVCRYUJBJVEBAK-QYVSTXNMSA-N.
| Molecular formula | C13H18N4O6 |
|---|---|
| Molecular weight | 326.31 g/mol |
| IUPAC name | 9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | YVCRYUJBJVEBAK-QYVSTXNMSA-N |
| SMILES | COCCO[C@@H]1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=CNC3=O)CO)O |
Computed by PubChem (NCBI)