CAS 545390-27-0 is the registry number for tert-Butyl O-(tert-butyl)-D-threoninate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R,3S)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate;hydrochloride (CAS 545390-27-0) is a chemical compound with the molecular formula C12H26ClNO3 and a molecular weight of 267.79 g/mol. IUPAC name: tert-butyl (2R,3S)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate;hydrochloride. InChIKey: OCOUBFTWQQJBIH-OULXEKPRSA-N.
| Molecular formula | C12H26ClNO3 |
|---|---|
| Molecular weight | 267.79 g/mol |
| IUPAC name | tert-butyl (2R,3S)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate;hydrochloride |
| InChIKey | OCOUBFTWQQJBIH-OULXEKPRSA-N |
| SMILES | C[C@@H]([C@H](C(=O)OC(C)(C)C)N)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)