Products 54556-99-9

CAS 54556-99-9 is the registry number for Propiverine Chloro Impurity HCl. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(1-methylpiperidin-4-yl) 2-chloro-2,2-diphenylacetate;hydrochloride (CAS 54556-99-9) is a chemical compound with the molecular formula C20H23Cl2NO2 and a molecular weight of 380.3 g/mol. IUPAC name: (1-methylpiperidin-4-yl) 2-chloro-2,2-diphenylacetate;hydrochloride. InChIKey: OMVSMIXIHMPFDR-UHFFFAOYSA-N.

Identity
Molecular formulaC20H23Cl2NO2
Molecular weight380.3 g/mol
IUPAC name(1-methylpiperidin-4-yl) 2-chloro-2,2-diphenylacetate;hydrochloride
InChIKeyOMVSMIXIHMPFDR-UHFFFAOYSA-N
SMILESCN1CCC(CC1)OC(=O)C(C2=CC=CC=C2)(C3=CC=CC=C3)Cl.Cl

Computed by PubChem (NCBI)