CAS 54556-99-9 is the registry number for Propiverine Chloro Impurity HCl. Offered by: Chemat Brand. Available pack sizes: on request.
(1-methylpiperidin-4-yl) 2-chloro-2,2-diphenylacetate;hydrochloride (CAS 54556-99-9) is a chemical compound with the molecular formula C20H23Cl2NO2 and a molecular weight of 380.3 g/mol. IUPAC name: (1-methylpiperidin-4-yl) 2-chloro-2,2-diphenylacetate;hydrochloride. InChIKey: OMVSMIXIHMPFDR-UHFFFAOYSA-N.
| Molecular formula | C20H23Cl2NO2 |
|---|---|
| Molecular weight | 380.3 g/mol |
| IUPAC name | (1-methylpiperidin-4-yl) 2-chloro-2,2-diphenylacetate;hydrochloride |
| InChIKey | OMVSMIXIHMPFDR-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)OC(=O)C(C2=CC=CC=C2)(C3=CC=CC=C3)Cl.Cl |
Computed by PubChem (NCBI)