CAS 546069-32-3 is the registry number for (3-(2,6-dichlorophenyl)-5-methylisoxazol-4-yl)-N-prop-2-enylformamide. Offered by: Biosynth. Available pack sizes: 250mg.
3-(2,6-dichlorophenyl)-5-methyl-N-prop-2-enyl-1,2-oxazole-4-carboxamide (CAS 546069-32-3) is a chemical compound with the molecular formula C14H12Cl2N2O2 and a molecular weight of 311.2 g/mol. IUPAC name: 3-(2,6-dichlorophenyl)-5-methyl-N-prop-2-enyl-1,2-oxazole-4-carboxamide. InChIKey: PGYBCDPLAPYNRG-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2N2O2 |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | 3-(2,6-dichlorophenyl)-5-methyl-N-prop-2-enyl-1,2-oxazole-4-carboxamide |
| InChIKey | PGYBCDPLAPYNRG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)NCC=C |
Computed by PubChem (NCBI)