Products 546105-61-7
CAS 546105-61-7 is the registry number for Carbonic anhydrase inhibitor 7. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(1,3-benzodioxol-5-yl)-N-(4-sulfamoylphenyl)quinoline-4-carboxamide (CAS 546105-61-7) is a chemical compound with the molecular formula C23H17N3O5S and a molecular weight of 447.5 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-N-(4-sulfamoylphenyl)quinoline-4-carboxamide. InChIKey: RUZZTBSPLOGDOG-UHFFFAOYSA-N.
| Molecular formula | C23H17N3O5S |
|---|---|
| Molecular weight | 447.5 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)-N-(4-sulfamoylphenyl)quinoline-4-carboxamide |
| InChIKey | RUZZTBSPLOGDOG-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NC4=CC=CC=C4C(=C3)C(=O)NC5=CC=C(C=C5)S(=O)(=O)N |
Computed by PubChem (NCBI)