Products 54612-75-8
CAS 54612-75-8 is the registry number for α-Prumycin hydrochloride. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-2-amino-N-[(3S,4R,5R,6R)-5-amino-4,6-dihydroxyoxan-3-yl]propanamide;dihydrochloride (CAS 54612-75-8) is a chemical compound with the molecular formula C8H19Cl2N3O4 and a molecular weight of 292.16 g/mol. IUPAC name: (2R)-2-amino-N-[(3S,4R,5R,6R)-5-amino-4,6-dihydroxyoxan-3-yl]propanamide;dihydrochloride. InChIKey: DXJVDHMFYXZNTJ-PGLKKYHWSA-N.
| Molecular formula | C8H19Cl2N3O4 |
|---|---|
| Molecular weight | 292.16 g/mol |
| IUPAC name | (2R)-2-amino-N-[(3S,4R,5R,6R)-5-amino-4,6-dihydroxyoxan-3-yl]propanamide;dihydrochloride |
| InChIKey | DXJVDHMFYXZNTJ-PGLKKYHWSA-N |
| SMILES | C[C@H](C(=O)N[C@H]1CO[C@H]([C@@H]([C@H]1O)N)O)N.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
alpha-Prumycin hydrochloride, orb3024286