CAS 54616-64-7 appears in our catalog under these names: Acedapsone Impurity 1, 4,4'-(Oxybis(4,1-phenylenesulfonyl))dianiline 98%, DAPSONE DIMER ETHER. Offered by: Chemat Brand, Ambeed, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 250mg.
4-[4-[4-(4-aminophenyl)sulfonylphenoxy]phenyl]sulfonylaniline (CAS 54616-64-7) is a chemical compound with the molecular formula C24H20N2O5S2 and a molecular weight of 480.6 g/mol. IUPAC name: 4-[4-[4-(4-aminophenyl)sulfonylphenoxy]phenyl]sulfonylaniline. InChIKey: CAIMXHCQEIPTCR-UHFFFAOYSA-N.
| Molecular formula | C24H20N2O5S2 |
|---|---|
| Molecular weight | 480.6 g/mol |
| IUPAC name | 4-[4-[4-(4-aminophenyl)sulfonylphenoxy]phenyl]sulfonylaniline |
| InChIKey | CAIMXHCQEIPTCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)C2=CC=C(C=C2)OC3=CC=C(C=C3)S(=O)(=O)C4=CC=C(C=C4)N |
Computed by PubChem (NCBI)