Products 54631-24-2
CAS 54631-24-2 appears in our catalog under these names: DL-threo-Ritalinic Acid (1mg/ml in Acetonitrile), DL-threo-Ritalinic Acid, >95% (HPLC), DL-threo-Ritalinic acid. Offered by: TRC, Biosynth. Available pack sizes: 5x1ml, 50mg, 5mg, 1mg, 10mg.
(2S)-2-phenyl-2-[(2S)-piperidin-2-yl]acetic acid (CAS 54631-24-2) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: (2S)-2-phenyl-2-[(2S)-piperidin-2-yl]acetic acid. InChIKey: INGSNVSERUZOAK-RYUDHWBXSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | (2S)-2-phenyl-2-[(2S)-piperidin-2-yl]acetic acid |
| InChIKey | INGSNVSERUZOAK-RYUDHWBXSA-N |
| SMILES | C1CCN[C@@H](C1)[C@H](C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)