CAS 5469-94-3 appears in our catalog under these names: N,N'-Di-p-tolyl-malonamide, 95%, N1,N3-Di-p-tolylmalonamide, 97%, N,N'-Bis(4-methylphenyl)propanediamide, N1,N3-Di-p-tolylmalonamide, 95%, 95%, N1,N3-di-p-tolylmalonamide, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 2,5g, 100mg.
N,N'-bis(4-methylphenyl)propanediamide (CAS 5469-94-3) is a chemical compound with the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. IUPAC name: N,N'-bis(4-methylphenyl)propanediamide. InChIKey: CIGKFIJIRVGTGE-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O2 |
|---|---|
| Molecular weight | 282.34 g/mol |
| IUPAC name | N,N'-bis(4-methylphenyl)propanediamide |
| InChIKey | CIGKFIJIRVGTGE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)CC(=O)NC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)