CAS 5470-66-6 appears in our catalog under these names: 2–Methyl–4–nitropyridine N–Oxide, 2-Methyl-4-nitropyridine-N-oxide, 2-Methyl-4-nitropyridine N-Oxide, >98.0%(GC)(T), 4-Nitro-2-picoline N-oxide 98%, 2-METHYL-4-NITROPYRIDINE N-OXIDE, 97%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 50g, 5g, 250g, 500g, 1g, 10g.
2-methyl-4-nitro-1-oxidopyridin-1-ium (CAS 5470-66-6) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: 2-methyl-4-nitro-1-oxidopyridin-1-ium. InChIKey: FTTIAVRPJGCXAC-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O3 |
|---|---|
| Molecular weight | 154.12 g/mol |
| IUPAC name | 2-methyl-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | FTTIAVRPJGCXAC-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C=CC(=C1)[N+](=O)[O-])[O-] |
Computed by PubChem (NCBI)