CAS 5470-75-7 appears in our catalog under these names: 6-Chloroquinolin-8-amine, 95%, 6–Chloroquinolin–8–amine, 6-Chloroquinolin-8-amine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
6-chloroquinolin-8-amine (CAS 5470-75-7) is a chemical compound with the molecular formula C9H7ClN2 and a molecular weight of 178.62 g/mol. IUPAC name: 6-chloroquinolin-8-amine. InChIKey: RRFMPCSQKFOUFO-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2 |
|---|---|
| Molecular weight | 178.62 g/mol |
| IUPAC name | 6-chloroquinolin-8-amine |
| InChIKey | RRFMPCSQKFOUFO-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)N)Cl |
Computed by PubChem (NCBI)