CAS 54732-63-7 is the registry number for 4-Bromo-3-chloro-2,5,6-trifluoropyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-bromo-3-chloro-2,5,6-trifluoropyridine (CAS 54732-63-7) is a chemical compound with the molecular formula C5BrClF3N and a molecular weight of 246.41 g/mol. IUPAC name: 4-bromo-3-chloro-2,5,6-trifluoropyridine. InChIKey: XRQBCXSMTBONCN-UHFFFAOYSA-N.
| Molecular formula | C5BrClF3N |
|---|---|
| Molecular weight | 246.41 g/mol |
| IUPAC name | 4-bromo-3-chloro-2,5,6-trifluoropyridine |
| InChIKey | XRQBCXSMTBONCN-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(N=C1F)F)Cl)Br)F |
Computed by PubChem (NCBI)