CAS 54735-61-4 appears in our catalog under these names: Inosine-5'-diphosphoric acid disodium salt, 97%, Inosine-5-diphosphoric Acid Disodium Salt, Inosine–5'–diphosphoric acid disodium salt, Inosine 5'-diphosphate disodium salt, Inosine-5'-diphosphoric acid disodium salt, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 25g, 1g, 5g, 500mg, 10g, 50g, 100g, 1 g.
Disodium;[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate (CAS 54735-61-4) is a chemical compound with the molecular formula C10H12N4Na2O11P2 and a molecular weight of 472.15 g/mol. IUPAC name: disodium;[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate. InChIKey: MYSOKTVZCUBKOZ-IDIVVRGQSA-L.
| Molecular formula | C10H12N4Na2O11P2 |
|---|---|
| Molecular weight | 472.15 g/mol |
| IUPAC name | disodium;[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate |
| InChIKey | MYSOKTVZCUBKOZ-IDIVVRGQSA-L |
| SMILES | C1=NC2=C(C(=O)N1)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)([O-])OP(=O)(O)[O-])O)O.[Na+].[Na+] |
Computed by PubChem (NCBI)