CAS 547696-48-0 is the registry number for N-(4-(((6-ethoxybenzothiazol-2-yl)amino)sulfonyl)phenyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfamoyl]phenyl]acetamide (CAS 547696-48-0) is a chemical compound with the molecular formula C17H17N3O4S2 and a molecular weight of 391.5 g/mol. IUPAC name: N-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfamoyl]phenyl]acetamide. InChIKey: INLYUQWKXNNRLV-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O4S2 |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | N-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfamoyl]phenyl]acetamide |
| InChIKey | INLYUQWKXNNRLV-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)N=C(S2)NS(=O)(=O)C3=CC=C(C=C3)NC(=O)C |
Computed by PubChem (NCBI)