CAS 54773-54-5 is the registry number for 2-Amino-5-iodobenzenesulfonamide, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-amino-5-iodobenzenesulfonamide (CAS 54773-54-5) is a chemical compound with the molecular formula C6H7IN2O2S and a molecular weight of 298.10 g/mol. IUPAC name: 2-amino-5-iodobenzenesulfonamide. InChIKey: TZPOFKNGJJYOPZ-UHFFFAOYSA-N.
| Molecular formula | C6H7IN2O2S |
|---|---|
| Molecular weight | 298.10 g/mol |
| IUPAC name | 2-amino-5-iodobenzenesulfonamide |
| InChIKey | TZPOFKNGJJYOPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)S(=O)(=O)N)N |
Computed by PubChem (NCBI)