CAS 547731-67-9 appears in our catalog under these names: BCPA, 98%, BCPA/ 99.06% (existing batch purity), BCPA, BCPA 98%, BCPA, 98.51%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 1mg, 25mg, 50mg, 100mg, 500mg, 250mg.
(E)-3-(2-chlorophenyl)-N-[4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]butyl]prop-2-enamide (CAS 547731-67-9) is a chemical compound with the molecular formula C22H22Cl2N2O2 and a molecular weight of 417.3 g/mol. IUPAC name: (E)-3-(2-chlorophenyl)-N-[4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]butyl]prop-2-enamide. InChIKey: KHDKYKZKDQMAKP-PHEQNACWSA-N.
| Molecular formula | C22H22Cl2N2O2 |
|---|---|
| Molecular weight | 417.3 g/mol |
| IUPAC name | (E)-3-(2-chlorophenyl)-N-[4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]butyl]prop-2-enamide |
| InChIKey | KHDKYKZKDQMAKP-PHEQNACWSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)NCCCCNC(=O)/C=C/C2=CC=CC=C2Cl)Cl |
Computed by PubChem (NCBI)