CAS 54789-92-3 appears in our catalog under these names: (2R,3R)-2,3-Dihydroxysuccinohydrazide 97%, (2R,3R)-2,3-Dihydroxysuccinohydrazide, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
(2R,3R)-2,3-dihydroxybutanedihydrazide (CAS 54789-92-3) is a chemical compound with the molecular formula C4H10N4O4 and a molecular weight of 178.15 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedihydrazide. InChIKey: MDJZGXRFYKPSIM-JCYAYHJZSA-N.
| Molecular formula | C4H10N4O4 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedihydrazide |
| InChIKey | MDJZGXRFYKPSIM-JCYAYHJZSA-N |
| SMILES | [C@@H]([C@H](C(=O)NN)O)(C(=O)NN)O |
Computed by PubChem (NCBI)