CAS 548-39-0 appears in our catalog under these names: Perinaphthenone, 95%, 1H-Phenalen-1-one, >95% (HPLC), Perinaphthenone, Perinaphthenone 95%, Phenalenone, 98%, 98%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 500mg, 2g, 100g, 250mg, 5g, 100 mg.
Phenalen-1-one (CAS 548-39-0) is a chemical compound with the molecular formula C13H8O and a molecular weight of 180.20 g/mol. IUPAC name: phenalen-1-one. InChIKey: WWBGWPHHLRSTFI-UHFFFAOYSA-N.
| Molecular formula | C13H8O |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | phenalen-1-one |
| InChIKey | WWBGWPHHLRSTFI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC(=O)C3=CC=C2 |
Computed by PubChem (NCBI)