CAS 548-54-9 appears in our catalog under these names: Violacein, Violacein, 99.97%, Violacein, 98%, 98%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 25mg, 1mg, 2mg, 5mg, 10mg, 5 mg, 1 mg.
3-[2-hydroxy-5-(5-hydroxy-1H-indol-3-yl)-1H-pyrrol-3-yl]indol-2-one (CAS 548-54-9) is a chemical compound with the molecular formula C20H13N3O3 and a molecular weight of 343.3 g/mol. IUPAC name: 3-[2-hydroxy-5-(5-hydroxy-1H-indol-3-yl)-1H-pyrrol-3-yl]indol-2-one. InChIKey: SHLJIZCPRXXHHZ-UHFFFAOYSA-N.
| Molecular formula | C20H13N3O3 |
|---|---|
| Molecular weight | 343.3 g/mol |
| IUPAC name | 3-[2-hydroxy-5-(5-hydroxy-1H-indol-3-yl)-1H-pyrrol-3-yl]indol-2-one |
| InChIKey | SHLJIZCPRXXHHZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=O)N=C2C=C1)C3=C(NC(=C3)C4=CNC5=C4C=C(C=C5)O)O |
Computed by PubChem (NCBI)